CAS 131172-64-0 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1h-indole-2-carboxylic acid, 95%, 4,5,6,7-Tetrahydro-1H-indole-2-carboxylic acid, 4,5,6,7-Tetrahydro-1H-indole-2-carboxylic acid 98%, 4,5,6,7-Tetrahydro-1h-indole-2-carboxylic acid, 98%, 98%, 4,5,6,7-Tetrahydro-1H-indole-2-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid (CAS 131172-64-0) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid. InChIKey: NYZDHGPFNPXPCM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid |
| InChIKey | NYZDHGPFNPXPCM-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)