CAS 13118-10-0 appears in our catalog under these names: 1-Methylpyrrolidin-3-yl 2-Cyclopentyl-2-hydroxy-2-phenylacetate Hydrochloride, 1–Methylpyrrolidin–3–yl 2–cyclopentyl–2–hydroxy–2–phenylacetate hydrochloride, Glycopyrrolate related B, AHR 376 95%, Glycopyrronium Bromide EP Impurity G. Offered by: Mikromol, GLPBio, Biosynth, Ambeed, Chemat Brand. Available pack sizes: 25mg, 100mg, 50mg, 250mg, 1000mg, 500mg, 1g, on request.
(1-methylpyrrolidin-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride (CAS 13118-10-0) is a chemical compound with the molecular formula C18H26ClNO3 and a molecular weight of 339.9 g/mol. IUPAC name: (1-methylpyrrolidin-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride. InChIKey: IUFZTNHOGFUUBG-UHFFFAOYSA-N.
| Molecular formula | C18H26ClNO3 |
|---|---|
| Molecular weight | 339.9 g/mol |
| IUPAC name | (1-methylpyrrolidin-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate;hydrochloride |
| InChIKey | IUFZTNHOGFUUBG-UHFFFAOYSA-N |
| SMILES | CN1CCC(C1)OC(=O)C(C2CCCC2)(C3=CC=CC=C3)O.Cl |
Computed by PubChem (NCBI)