CAS 2007919-62-0 is the registry number for Trans-tert-butyl (2-((4-chlorobenzyl)oxy)cyclohexyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-[(1R,2R)-2-[(4-chlorophenyl)methoxy]cyclohexyl]carbamate (CAS 2007919-62-0) is a chemical compound with the molecular formula C18H26ClNO3 and a molecular weight of 339.9 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-[(4-chlorophenyl)methoxy]cyclohexyl]carbamate. InChIKey: IBXGZPRXBKZDFT-HZPDHXFCSA-N.
| Molecular formula | C18H26ClNO3 |
|---|---|
| Molecular weight | 339.9 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-[(4-chlorophenyl)methoxy]cyclohexyl]carbamate |
| InChIKey | IBXGZPRXBKZDFT-HZPDHXFCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1OCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)