CAS 1311824-78-8 is the registry number for N-(tert-Butyl)-2-(2-methylthiazol-4-yl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide (CAS 1311824-78-8) is a chemical compound with the molecular formula C10H16N2OS and a molecular weight of 212.31 g/mol. IUPAC name: N-tert-butyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide. InChIKey: PUIQMWFKHSCBAV-UHFFFAOYSA-N.
| Molecular formula | C10H16N2OS |
|---|---|
| Molecular weight | 212.31 g/mol |
| IUPAC name | N-tert-butyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| InChIKey | PUIQMWFKHSCBAV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)CC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)