CAS 1824433-92-2 appears in our catalog under these names: 4,4,6,6-Tetramethyl-6,7-dihydro-4H-pyrano(4,3-d)thiazol-2-amine, 95%, 4,4,6,6-Tetramethyl-6,7-dihydro-4H-pyrano(4,3-d)thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,4,6,6-tetramethyl-7H-pyrano[4,3-d][1,3]thiazol-2-amine (CAS 1824433-92-2) is a chemical compound with the molecular formula C10H16N2OS and a molecular weight of 212.31 g/mol. IUPAC name: 4,4,6,6-tetramethyl-7H-pyrano[4,3-d][1,3]thiazol-2-amine. InChIKey: AJXRRFMAWXWOMT-UHFFFAOYSA-N.
| Molecular formula | C10H16N2OS |
|---|---|
| Molecular weight | 212.31 g/mol |
| IUPAC name | 4,4,6,6-tetramethyl-7H-pyrano[4,3-d][1,3]thiazol-2-amine |
| InChIKey | AJXRRFMAWXWOMT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(O1)(C)C)SC(=N2)N)C |
Computed by PubChem (NCBI)