CAS 1312077-05-6 appears in our catalog under these names: Rasagiline Impurity 12, (3R)-2,3-Dihydro-3-(2-propyn-1-ylamino)-1H-inden-1-one, >95% (HPLC), (3R)-3-(Prop-2-yn-1-ylamino)indan-1-one (3-Ketorasagiline), Rasagiline Impurity 11. Offered by: Chemat Brand, TRC, Mikromol, Hubei YoungXin. Available pack sizes: on request, 50mg, 5mg, 25mg, 10mg, 100mg, 200mg.
(3R)-3-(prop-2-ynylamino)-2,3-dihydroinden-1-one (CAS 1312077-05-6) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (3R)-3-(prop-2-ynylamino)-2,3-dihydroinden-1-one. InChIKey: NMRXLQWLAGHNGU-LLVKDONJSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (3R)-3-(prop-2-ynylamino)-2,3-dihydroinden-1-one |
| InChIKey | NMRXLQWLAGHNGU-LLVKDONJSA-N |
| SMILES | C#CCN[C@@H]1CC(=O)C2=CC=CC=C12 |
Computed by PubChem (NCBI)