Products 1312134-45-4
CAS 1312134-45-4 appears in our catalog under these names: 8-Bromoquinoline-7-carboxylic acid, 8-bromoquinoline-7-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
8-bromoquinoline-7-carboxylic acid (CAS 1312134-45-4) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 8-bromoquinoline-7-carboxylic acid. InChIKey: XGJDJAIDVHAYQC-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 8-bromoquinoline-7-carboxylic acid |
| InChIKey | XGJDJAIDVHAYQC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)C(=O)O)Br)N=C1 |
Computed by PubChem (NCBI)