CAS 1312304-07-6 is the registry number for Benzyl (S)-4-amino-2-((tert-butoxycarbonyl)amino)-4-thioxobutanoate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate (CAS 1312304-07-6) is a chemical compound with the molecular formula C16H22N2O4S and a molecular weight of 338.4 g/mol. IUPAC name: benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate. InChIKey: JMOLBYUUZZKKHG-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O4S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidenebutanoate |
| InChIKey | JMOLBYUUZZKKHG-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=S)N)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)