Products 54827-18-8
CAS 54827-18-8 appears in our catalog under these names: TMB monosulfate (BM blue monosulfate), TMB (monosulfate), 99.88%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mM (in 1ml dmso), 10mM/1mL, 100 mg.
4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;sulfuric acid (CAS 54827-18-8) is a chemical compound with the molecular formula C16H22N2O4S and a molecular weight of 338.4 g/mol. IUPAC name: 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;sulfuric acid. InChIKey: VJSXOBXXVSDFKR-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O4S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;sulfuric acid |
| InChIKey | VJSXOBXXVSDFKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)N)C.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
TMB monosulfate, TMB (monosulfate), 3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-4,4'-diamine sulfate, 3,3',5,5'-tetramethylbenzidine sulfate, 4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylaniline;sulfuric acid, orb1706329, 3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-4,4'-diaminesulfate, 4-(4-amino-3,5-dimethyl-phenyl)-2,6-dimethyl-aniline;sulfuric acid