CAS 1312356-10-7 is the registry number for 1-(Benzyloxy)-4-chloropyrido[2,3-d]pyrimidin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-1-phenylmethoxypyrido[2,3-d]pyrimidin-2-one (CAS 1312356-10-7) is a chemical compound with the molecular formula C14H10ClN3O2 and a molecular weight of 287.70 g/mol. IUPAC name: 4-chloro-1-phenylmethoxypyrido[2,3-d]pyrimidin-2-one. InChIKey: CVEGWIGMOAASAQ-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O2 |
|---|---|
| Molecular weight | 287.70 g/mol |
| IUPAC name | 4-chloro-1-phenylmethoxypyrido[2,3-d]pyrimidin-2-one |
| InChIKey | CVEGWIGMOAASAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CON2C3=C(C=CC=N3)C(=NC2=O)Cl |
Computed by PubChem (NCBI)