CAS 2447686-42-0 is the registry number for 2-Benzyl-4-chloropyrido[3,2-c]pyridazine-3,6(2H,5H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzyl-4-chloro-5H-pyrido[3,2-c]pyridazine-3,6-dione (CAS 2447686-42-0) is a chemical compound with the molecular formula C14H10ClN3O2 and a molecular weight of 287.70 g/mol. IUPAC name: 2-benzyl-4-chloro-5H-pyrido[3,2-c]pyridazine-3,6-dione. InChIKey: RIAMVQMCWSUDAI-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O2 |
|---|---|
| Molecular weight | 287.70 g/mol |
| IUPAC name | 2-benzyl-4-chloro-5H-pyrido[3,2-c]pyridazine-3,6-dione |
| InChIKey | RIAMVQMCWSUDAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C(=C3C(=N2)C=CC(=O)N3)Cl |
Computed by PubChem (NCBI)