CAS 1312479-18-7 is the registry number for 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-2H-1,2,3-triazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]triazole (CAS 1312479-18-7) is a chemical compound with the molecular formula C14H18BN3O2 and a molecular weight of 271.12 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]triazole. InChIKey: LPMLXBQJYQBVPF-UHFFFAOYSA-N.
| Molecular formula | C14H18BN3O2 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]triazole |
| InChIKey | LPMLXBQJYQBVPF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3N=CC=N3 |
Computed by PubChem (NCBI)