CAS 2409082-81-9 is the registry number for 7-(Tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-2-amine (CAS 2409082-81-9) is a chemical compound with the molecular formula C14H18BN3O2 and a molecular weight of 271.12 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-2-amine. InChIKey: ACCNHUPBDDHAAS-UHFFFAOYSA-N.
| Molecular formula | C14H18BN3O2 |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-2-amine |
| InChIKey | ACCNHUPBDDHAAS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NC(=NC=C3C=C2)N |
Computed by PubChem (NCBI)