CAS 1312479-26-7 appears in our catalog under these names: 4-(4-Tetrahydropyranyl)phenylboronic acid pinacol ester, 98%, 4–(4–Tetrahydropyranyl)phenylboronic Acid Pinacol Ester, 4-(4-Tetrahydropyranyl)phenylboronic acid pinacol ester, 4-(4-Tetrahydropyranyl)phenylboronic Acid Pinacol Ester 95%, 4,4,5,5-Tetramethyl-2-(4-(tetrahydro-2h-pyran-4-yl)phenyl)-1,3,2-dioxaborolane, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
4,4,5,5-tetramethyl-2-[4-(oxan-4-yl)phenyl]-1,3,2-dioxaborolane (CAS 1312479-26-7) is a chemical compound with the molecular formula C17H25BO3 and a molecular weight of 288.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(oxan-4-yl)phenyl]-1,3,2-dioxaborolane. InChIKey: DMLXOYKSKYTGKQ-UHFFFAOYSA-N.
| Molecular formula | C17H25BO3 |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(oxan-4-yl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | DMLXOYKSKYTGKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCOCC3 |
Computed by PubChem (NCBI)