Products 2304635-71-8
CAS 2304635-71-8 is the registry number for 2-(3-(Benzyloxy)cyclobutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-(3-phenylmethoxycyclobutyl)-1,3,2-dioxaborolane (CAS 2304635-71-8) is a chemical compound with the molecular formula C17H25BO3 and a molecular weight of 288.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-phenylmethoxycyclobutyl)-1,3,2-dioxaborolane. InChIKey: BBLXQXYOTXFPEG-UHFFFAOYSA-N.
| Molecular formula | C17H25BO3 |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-phenylmethoxycyclobutyl)-1,3,2-dioxaborolane |
| InChIKey | BBLXQXYOTXFPEG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC(C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)