Products 1312697-72-5
CAS 1312697-72-5 is the registry number for methyl 8-bromoimidazo[1,2-a]pyridine-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 8-bromoimidazo[1,2-a]pyridine-5-carboxylate (CAS 1312697-72-5) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 8-bromoimidazo[1,2-a]pyridine-5-carboxylate. InChIKey: UDAAHTRLAJOPIN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 8-bromoimidazo[1,2-a]pyridine-5-carboxylate |
| InChIKey | UDAAHTRLAJOPIN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=NC=CN12)Br |
Computed by PubChem (NCBI)