CAS 1312766-58-7 is the registry number for 2-(2-fluorophenyl)-n'-hydroxyethanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2-fluorophenyl)-N'-hydroxyethanimidamide (CAS 1312766-58-7) is a chemical compound with the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. IUPAC name: 2-(2-fluorophenyl)-N'-hydroxyethanimidamide. InChIKey: RBOFWRSUZSOXOE-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O |
|---|---|
| Molecular weight | 168.17 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | RBOFWRSUZSOXOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C/C(=N/O)/N)F |
Computed by PubChem (NCBI)