Products 1312766-58-7

CAS 1312766-58-7 is the registry number for 2-(2-fluorophenyl)-n'-hydroxyethanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(2-fluorophenyl)-N'-hydroxyethanimidamide (CAS 1312766-58-7) is a chemical compound with the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. IUPAC name: 2-(2-fluorophenyl)-N'-hydroxyethanimidamide. InChIKey: RBOFWRSUZSOXOE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9FN2O
Molecular weight168.17 g/mol
IUPAC name2-(2-fluorophenyl)-N'-hydroxyethanimidamide
InChIKeyRBOFWRSUZSOXOE-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C/C(=N/O)/N)F

Computed by PubChem (NCBI)