CAS 238742-80-8 appears in our catalog under these names: 3-Fluoro-4-methylbenzamide oxime, 95%, 3-Fluoro-4-methylbenzamideoxime, 97%, 3-Fluoro-4-methylbenzamide oxime, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 25g.
3-fluoro-N'-hydroxy-4-methylbenzenecarboximidamide (CAS 238742-80-8) is a chemical compound with the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. IUPAC name: 3-fluoro-N'-hydroxy-4-methylbenzenecarboximidamide. InChIKey: RCNTZYAQXVFCBQ-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O |
|---|---|
| Molecular weight | 168.17 g/mol |
| IUPAC name | 3-fluoro-N'-hydroxy-4-methylbenzenecarboximidamide |
| InChIKey | RCNTZYAQXVFCBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)/C(=N/O)/N)F |
Computed by PubChem (NCBI)