CAS 1312771-60-0 is the registry number for (4R)-tert-Butyl 4-hydroxyhexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4R)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (CAS 1312771-60-0) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (4R)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate. InChIKey: LVSMJGHUOLKTJI-UDNWOFFPSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (4R)-4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | LVSMJGHUOLKTJI-UDNWOFFPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC[C@H](C2C1)O |
Computed by PubChem (NCBI)