Products 131278-84-7
CAS 131278-84-7 is the registry number for ETHYL (2R,4R)-4-METHYL-2-PIPERIDINECARBOXYLATE L-TARTRATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g.
(2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2R,4R)-4-methylpiperidine-2-carboxylate (CAS 131278-84-7) is a chemical compound with the molecular formula C13H23NO8 and a molecular weight of 321.32 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2R,4R)-4-methylpiperidine-2-carboxylate. InChIKey: LKQJOTYRDSQDNJ-SKDUITIKSA-N.
| Molecular formula | C13H23NO8 |
|---|---|
| Molecular weight | 321.32 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2R,4R)-4-methylpiperidine-2-carboxylate |
| InChIKey | LKQJOTYRDSQDNJ-SKDUITIKSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H](CCN1)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)