Products 1401618-23-2
CAS 1401618-23-2 is the registry number for ethyl (2S，4S)–4–methyl–2–pipecolate. Offered by: GLPBio. Available pack sizes: 200mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S,4S)-4-methylpiperidine-2-carboxylate (CAS 1401618-23-2) is a chemical compound with the molecular formula C13H23NO8 and a molecular weight of 321.32 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S,4S)-4-methylpiperidine-2-carboxylate. InChIKey: LKQJOTYRDSQDNJ-QRJBQDOGSA-N.
| Molecular formula | C13H23NO8 |
|---|---|
| Molecular weight | 321.32 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S,4S)-4-methylpiperidine-2-carboxylate |
| InChIKey | LKQJOTYRDSQDNJ-QRJBQDOGSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H](CCN1)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)