Products 1313028-09-9
CAS 1313028-09-9 appears in our catalog under these names: 2-(2-Cyclopropylethynyl)benzoic Acid, 2-(Cyclopropylethynyl)benzoic acid, 98%, ABzOH/ 99.62% (existing batch purity), ABzOH 98%, 2-(Cyclopropylethynyl)benzoic acid, 98%, 98%. Offered by: TRC, AmBeed, TargetMol, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1mg, 5mg, 10mg, 25mg, 50mg.
2-(2-cyclopropylethynyl)benzoic acid (CAS 1313028-09-9) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 2-(2-cyclopropylethynyl)benzoic acid. InChIKey: UCAPNHYQJXDWDX-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-(2-cyclopropylethynyl)benzoic acid |
| InChIKey | UCAPNHYQJXDWDX-UHFFFAOYSA-N |
| SMILES | C1CC1C#CC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)