CAS 1313054-52-2 appears in our catalog under these names: Fmoc-d-gln(xan)-oh, 98%, FMoc-d-gln(xan)-oh, 95%, Fmoc-D-Gln(Xan)-OH 98%, Fmoc-D-Gln(Xan)-OH, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid (CAS 1313054-52-2) is a chemical compound with the molecular formula C33H28N2O6 and a molecular weight of 548.6 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid. InChIKey: DQGRFJKGDGJKFV-HHHXNRCGSA-N.
| Molecular formula | C33H28N2O6 |
|---|---|
| Molecular weight | 548.6 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid |
| InChIKey | DQGRFJKGDGJKFV-HHHXNRCGSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(=O)NC4C5=CC=CC=C5OC6=CC=CC=C46)C(=O)O |
Computed by PubChem (NCBI)