CAS 185031-81-6 appears in our catalog under these names: Fmoc-gln(xan)-oh, 98%, FMOC-GLN(XAN)-OH 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 10g, 5g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid (CAS 185031-81-6) is a chemical compound with the molecular formula C33H28N2O6 and a molecular weight of 548.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid. InChIKey: DQGRFJKGDGJKFV-MHZLTWQESA-N.
| Molecular formula | C33H28N2O6 |
|---|---|
| Molecular weight | 548.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-(9H-xanthen-9-ylamino)pentanoic acid |
| InChIKey | DQGRFJKGDGJKFV-MHZLTWQESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)NC4C5=CC=CC=C5OC6=CC=CC=C46)C(=O)O |
Computed by PubChem (NCBI)