CAS 13132-94-0 is the registry number for 1,1'-(Oxybis(4,1-phenylene))bis(1H-pyrrole-2,5-dione), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
1-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrole-2,5-dione (CAS 13132-94-0) is a chemical compound with the molecular formula C20H12N2O5 and a molecular weight of 360.3 g/mol. IUPAC name: 1-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrole-2,5-dione. InChIKey: XOJRVZIYCCJCRD-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O5 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 1-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrole-2,5-dione |
| InChIKey | XOJRVZIYCCJCRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)OC3=CC=C(C=C3)N4C(=O)C=CC4=O |
Computed by PubChem (NCBI)