CAS 2288716-06-1 is the registry number for (2E)-2,4-Bis(1,3-dioxoisoindol-2-yl)but-2-enal, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(E)-2,4-bis(1,3-dioxoisoindol-2-yl)but-2-enal (CAS 2288716-06-1) is a chemical compound with the molecular formula C20H12N2O5 and a molecular weight of 360.3 g/mol. IUPAC name: (E)-2,4-bis(1,3-dioxoisoindol-2-yl)but-2-enal. InChIKey: FHHIUGYXPMPBER-FMIVXFBMSA-N.
| Molecular formula | C20H12N2O5 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | (E)-2,4-bis(1,3-dioxoisoindol-2-yl)but-2-enal |
| InChIKey | FHHIUGYXPMPBER-FMIVXFBMSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C/C=C(\C=O)/N3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)