Products 1313277-22-3
CAS 1313277-22-3 appears in our catalog under these names: (R)-6,6-Dimethyl-morpholine-3-carboxylic acid hydrochloride, 95%, (R)-6,6-Dimethyl-morpholine-3-carboxylic acid hcl, 95%, 95%, (R)-6,6-DIMETHYL-MORPHOLINE-3-CARBOXYLIC ACID HCL, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 1g.
(3R)-6,6-dimethylmorpholine-3-carboxylic acid;hydrochloride (CAS 1313277-22-3) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: (3R)-6,6-dimethylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: JCLGQALHYUKMJK-NUBCRITNSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (3R)-6,6-dimethylmorpholine-3-carboxylic acid;hydrochloride |
| InChIKey | JCLGQALHYUKMJK-NUBCRITNSA-N |
| SMILES | CC1(CN[C@H](CO1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)