CAS 131331-98-1 is the registry number for 5,5,8,8-Tetramethyl-6,7-dihydronaphthalene-2-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonitrile (CAS 131331-98-1) is a chemical compound with the molecular formula C15H19N and a molecular weight of 213.32 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonitrile. InChIKey: MHTZJQCDPRSBKF-UHFFFAOYSA-N.
| Molecular formula | C15H19N |
|---|---|
| Molecular weight | 213.32 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonitrile |
| InChIKey | MHTZJQCDPRSBKF-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C#N)(C)C)C |
Computed by PubChem (NCBI)