CAS 324034-56-2 is the registry number for (S)-α-tert-Butyl-1-naphthylmethylamine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S)-2,2-dimethyl-1-naphthalen-1-ylpropan-1-amine (CAS 324034-56-2) is a chemical compound with the molecular formula C15H19N and a molecular weight of 213.32 g/mol. IUPAC name: (1S)-2,2-dimethyl-1-naphthalen-1-ylpropan-1-amine. InChIKey: FQTPRCXAYUOOGA-CQSZACIVSA-N.
| Molecular formula | C15H19N |
|---|---|
| Molecular weight | 213.32 g/mol |
| IUPAC name | (1S)-2,2-dimethyl-1-naphthalen-1-ylpropan-1-amine |
| InChIKey | FQTPRCXAYUOOGA-CQSZACIVSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC=CC2=CC=CC=C21)N |
Computed by PubChem (NCBI)