CAS 1313358-70-1 is the registry number for Methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate (CAS 1313358-70-1) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate. InChIKey: VUSQBNNLIDLIBW-WDSKDSINSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | trans-methyl (1R,3S)-3-amino-2,2-dimethylcyclobutane-1-carboxylate |
| InChIKey | VUSQBNNLIDLIBW-WDSKDSINSA-N |
| SMILES | CC1([C@@H](C[C@@H]1N)C(=O)OC)C |
Computed by PubChem (NCBI)