CAS 1313393-58-6 appears in our catalog under these names: MPPP Hydrochloride, 4-MePPP HCl (4-Methyl-alpha-pyrrolidinopropiophenone Hydrochloride), 4-MePPP HCl (4-Methyl-alpha-pyrrolidinopropiophenone Hydrochloride) 1.0 mg/ml in Methanol (as free base), 4'-Methyl-a-pyrrolidinopropiophenone hydrochloride. Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 100mg, 10mg, 1ml, 2g, 5g, 10g, 25g.
1-(4-methylphenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride (CAS 1313393-58-6) is a chemical compound with the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. IUPAC name: 1-(4-methylphenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride. InChIKey: MRWBETWZAYOULZ-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO |
|---|---|
| Molecular weight | 253.77 g/mol |
| IUPAC name | 1-(4-methylphenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride |
| InChIKey | MRWBETWZAYOULZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)N2CCCC2.Cl |
Computed by PubChem (NCBI)