CAS 1375930-97-4 appears in our catalog under these names: 4-Chloromethyl-n,n-diisopropylbenzamide, 95%, 4-(Chloromethyl)-N,N-bis(1-methylethyl)benzamide, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g.
4-(chloromethyl)-N,N-di(propan-2-yl)benzamide (CAS 1375930-97-4) is a chemical compound with the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. IUPAC name: 4-(chloromethyl)-N,N-di(propan-2-yl)benzamide. InChIKey: IWHDTZURUKJHFU-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO |
|---|---|
| Molecular weight | 253.77 g/mol |
| IUPAC name | 4-(chloromethyl)-N,N-di(propan-2-yl)benzamide |
| InChIKey | IWHDTZURUKJHFU-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)CCl |
Computed by PubChem (NCBI)