Products 1313400-91-7
CAS 1313400-91-7 appears in our catalog under these names: 4–oxo–2–Nonenal–d3, 4-Oxo-2(E)-nonenal-d3, (E)-4-Oxo-2-nonenal-d3. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 100μg, 50μg, 500μg, 100 μg.
(E)-9,9,9-trideuterio-4-oxonon-2-enal (CAS 1313400-91-7) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 157.22 g/mol. IUPAC name: (E)-9,9,9-trideuterio-4-oxonon-2-enal. InChIKey: SEPPVOUBHWNCAW-PKJLGKQPSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 157.22 g/mol |
| IUPAC name | (E)-9,9,9-trideuterio-4-oxonon-2-enal |
| InChIKey | SEPPVOUBHWNCAW-PKJLGKQPSA-N |
| SMILES | [2H]C([2H])([2H])CCCCC(=O)/C=C/C=O |
Computed by PubChem (NCBI)