CAS 1313429-36-5 appears in our catalog under these names: (AlphaR,BetaS)-Beta-Ethyl-3-methoxy-Alpha-methylbenzenepropanoic Acid, (aR,bS)-b-Ethyl-3-methoxy-a-methylbenzenepropanoic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(2R,3S)-3-(3-methoxyphenyl)-2-methylpentanoic acid (CAS 1313429-36-5) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: (2R,3S)-3-(3-methoxyphenyl)-2-methylpentanoic acid. InChIKey: KVBCBJRMNRDEKL-SKDRFNHKSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | (2R,3S)-3-(3-methoxyphenyl)-2-methylpentanoic acid |
| InChIKey | KVBCBJRMNRDEKL-SKDRFNHKSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)OC)[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)