Products 1313439-71-2
CAS 1313439-71-2 appears in our catalog under these names: ALM301, Engasertib, 99.65%, 6-[4-(cis-1-Amino-3-hydroxycyclobutyl)phenyl]-1-ethyl-7-phenyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, 99%, 99%, ALM301, 98%. Offered by: GLPBio, MedChemExpress, Chemat, Ambeed. Available pack sizes: 1mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL, 25 mg, 100 mg, 50 mg, 10 mg.
6-[4-(1-amino-3-hydroxycyclobutyl)phenyl]-1-ethyl-7-phenylpyrido[2,3-b][1,4]oxazin-2-one (CAS 1313439-71-2) is a chemical compound with the molecular formula C25H25N3O3 and a molecular weight of 415.5 g/mol. IUPAC name: 6-[4-(1-amino-3-hydroxycyclobutyl)phenyl]-1-ethyl-7-phenylpyrido[2,3-b][1,4]oxazin-2-one. InChIKey: BPHCAPAOSHZYJY-UHFFFAOYSA-N.
| Molecular formula | C25H25N3O3 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 6-[4-(1-amino-3-hydroxycyclobutyl)phenyl]-1-ethyl-7-phenylpyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | BPHCAPAOSHZYJY-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)COC2=C1C=C(C(=N2)C3=CC=C(C=C3)C4(CC(C4)O)N)C5=CC=CC=C5 |
Computed by PubChem (NCBI)