Products 430462-93-4
CAS 430462-93-4 appears in our catalog under these names: HQ–415, HQ-415, 98.10%, 98.10%, HQ-415, 98.05%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 2mg, 5mg, 50mg, 50 mg, 10 mg.
7-[(3-ethoxy-4-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (CAS 430462-93-4) is a chemical compound with the molecular formula C25H25N3O3 and a molecular weight of 415.5 g/mol. IUPAC name: 7-[(3-ethoxy-4-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol. InChIKey: ZUOOFZJZQYFZQW-UHFFFAOYSA-N.
| Molecular formula | C25H25N3O3 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 7-[(3-ethoxy-4-methoxyphenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| InChIKey | ZUOOFZJZQYFZQW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(C2=C(C3=C(C=CC=N3)C=C2)O)NC4=NC=CC(=C4)C)OC |
Computed by PubChem (NCBI)