Products 1313516-26-5
CAS 1313516-26-5 appears in our catalog under these names: L–ANAP, L-ANAP, L-ANAP 98+%, (2S)-3-[(6-Acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid, 98+%, 98+%, L-ANAP, 99.89%. Offered by: GLPBio, TRC, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 25mg, 50mg, 250mg, 1g, 10 mg.
(2S)-3-[(6-acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid (CAS 1313516-26-5) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: (2S)-3-[(6-acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid. InChIKey: XKZCXMNMUMGDJG-AWEZNQCLSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2S)-3-[(6-acetylnaphthalen-2-yl)amino]-2-aminopropanoic acid |
| InChIKey | XKZCXMNMUMGDJG-AWEZNQCLSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)NC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)