Products 1313585-95-3
CAS 1313585-95-3 is the registry number for (1S,3S)-1-Methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide (CAS 1313585-95-3) is a chemical compound with the molecular formula C13H16N4O and a molecular weight of 244.29 g/mol. IUPAC name: (1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide. InChIKey: JBWBBKSDBPQCII-CPCISQLKSA-N.
| Molecular formula | C13H16N4O |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide |
| InChIKey | JBWBBKSDBPQCII-CPCISQLKSA-N |
| SMILES | C[C@H]1C2=C(C[C@H](N1)C(=O)NN)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)