CAS 1313588-91-8 appears in our catalog under these names: 5'-Bromo-2'-fluoro-3'-nitroacetanilide, 95%, 5'-Bromo-2'-fluoro-3'-nitroacetanilide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
N-(5-bromo-2-fluoro-3-nitrophenyl)acetamide (CAS 1313588-91-8) is a chemical compound with the molecular formula C8H6BrFN2O3 and a molecular weight of 277.05 g/mol. IUPAC name: N-(5-bromo-2-fluoro-3-nitrophenyl)acetamide. InChIKey: LLVZYBUNUQDKML-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFN2O3 |
|---|---|
| Molecular weight | 277.05 g/mol |
| IUPAC name | N-(5-bromo-2-fluoro-3-nitrophenyl)acetamide |
| InChIKey | LLVZYBUNUQDKML-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=CC(=C1)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)