CAS 95635-46-4 appears in our catalog under these names: 4-Bromo-2-fluoro-5-nitroacetanilide, 4'-Bromo-2'-fluoro-5'-nitroacetanilide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
N-(4-bromo-2-fluoro-5-nitrophenyl)acetamide (CAS 95635-46-4) is a chemical compound with the molecular formula C8H6BrFN2O3 and a molecular weight of 277.05 g/mol. IUPAC name: N-(4-bromo-2-fluoro-5-nitrophenyl)acetamide. InChIKey: HNCIFIQHBRCORZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFN2O3 |
|---|---|
| Molecular weight | 277.05 g/mol |
| IUPAC name | N-(4-bromo-2-fluoro-5-nitrophenyl)acetamide |
| InChIKey | HNCIFIQHBRCORZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)