Products 1313712-73-0

CAS 1313712-73-0 is the registry number for 7-Chloro-6-fluoro-2-methyl-quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

7-chloro-6-fluoro-2-methylquinoline-4-carboxylic acid (CAS 1313712-73-0) is a chemical compound with the molecular formula C11H7ClFNO2 and a molecular weight of 239.63 g/mol. IUPAC name: 7-chloro-6-fluoro-2-methylquinoline-4-carboxylic acid. InChIKey: YYHDVUHAORJIKY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClFNO2
Molecular weight239.63 g/mol
IUPAC name7-chloro-6-fluoro-2-methylquinoline-4-carboxylic acid
InChIKeyYYHDVUHAORJIKY-UHFFFAOYSA-N
SMILESCC1=CC(=C2C=C(C(=CC2=N1)Cl)F)C(=O)O

Computed by PubChem (NCBI)