Products 465514-05-0

CAS 465514-05-0 is the registry number for 3-(4-Fluorophenyl)-5-methyl-4-isoxazolecarbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS 465514-05-0) is a chemical compound with the molecular formula C11H7ClFNO2 and a molecular weight of 239.63 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride. InChIKey: QRMOQEHQPOIZGC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClFNO2
Molecular weight239.63 g/mol
IUPAC name3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
InChIKeyQRMOQEHQPOIZGC-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC=C(C=C2)F)C(=O)Cl

Computed by PubChem (NCBI)