CAS 465514-05-0 is the registry number for 3-(4-Fluorophenyl)-5-methyl-4-isoxazolecarbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS 465514-05-0) is a chemical compound with the molecular formula C11H7ClFNO2 and a molecular weight of 239.63 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride. InChIKey: QRMOQEHQPOIZGC-UHFFFAOYSA-N.
| Molecular formula | C11H7ClFNO2 |
|---|---|
| Molecular weight | 239.63 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride |
| InChIKey | QRMOQEHQPOIZGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)F)C(=O)Cl |
Computed by PubChem (NCBI)