CAS 131373-86-9 is the registry number for 2-(2,6-Dichloro-phenyl)-1,2-dihydropyrazolo[3,4-c]pyridin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-(2,6-dichlorophenyl)-1H-pyrazolo[3,4-c]pyridin-3-one (CAS 131373-86-9) is a chemical compound with the molecular formula C12H7Cl2N3O and a molecular weight of 280.11 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-1H-pyrazolo[3,4-c]pyridin-3-one. InChIKey: ASXDOYMNDNXVBE-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3O |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-1H-pyrazolo[3,4-c]pyridin-3-one |
| InChIKey | ASXDOYMNDNXVBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N2C(=O)C3=C(N2)C=NC=C3)Cl |
Computed by PubChem (NCBI)