CAS 1624261-22-8 is the registry number for 2-(2,6)-Dichlorophenyl-1,2-dihydro-3h-pyrazolo[4,3-c] pyridine-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,6-dichlorophenyl)-1H-pyrazolo[4,3-c]pyridin-3-one (CAS 1624261-22-8) is a chemical compound with the molecular formula C12H7Cl2N3O and a molecular weight of 280.11 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-1H-pyrazolo[4,3-c]pyridin-3-one. InChIKey: RFXJFBHXKPUXHG-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3O |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-1H-pyrazolo[4,3-c]pyridin-3-one |
| InChIKey | RFXJFBHXKPUXHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N2C(=O)C3=C(N2)C=CN=C3)Cl |
Computed by PubChem (NCBI)