CAS 1313760-30-3 appears in our catalog under these names: [5-Fluoro-2-(pyridin-4-ylmethoxy)phenyl]boranediol, 95%, {5-fluoro-2-((pyridin-4-yl)methoxy)phenyl}boronic acid, 95%, (5-Fluoro-2-(pyridin-4-ylmethoxy)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 0,5g, 50mg.
[5-fluoro-2-(pyridin-4-ylmethoxy)phenyl]boronic acid (CAS 1313760-30-3) is a chemical compound with the molecular formula C12H11BFNO3 and a molecular weight of 247.03 g/mol. IUPAC name: [5-fluoro-2-(pyridin-4-ylmethoxy)phenyl]boronic acid. InChIKey: WBYYLCBGOWSLDF-UHFFFAOYSA-N.
| Molecular formula | C12H11BFNO3 |
|---|---|
| Molecular weight | 247.03 g/mol |
| IUPAC name | [5-fluoro-2-(pyridin-4-ylmethoxy)phenyl]boronic acid |
| InChIKey | WBYYLCBGOWSLDF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCC2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)