CAS 2377609-45-3 appears in our catalog under these names: 5-(Benzyloxy)-6-fluoropyridin-3-ylboronic acid, 98%, (5-(Benzyloxy)-6-fluoropyridin-3-yl)boronic acid, 98%, 5-(Benzyloxy)-6-fluoropyridin-3-ylboronic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
(6-fluoro-5-phenylmethoxy-3-pyridinyl)boronic acid (CAS 2377609-45-3) is a chemical compound with the molecular formula C12H11BFNO3 and a molecular weight of 247.03 g/mol. IUPAC name: (6-fluoro-5-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: KVAGFQFCWZHMLE-UHFFFAOYSA-N.
| Molecular formula | C12H11BFNO3 |
|---|---|
| Molecular weight | 247.03 g/mol |
| IUPAC name | (6-fluoro-5-phenylmethoxy-3-pyridinyl)boronic acid |
| InChIKey | KVAGFQFCWZHMLE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)