CAS 1313760-71-2 is the registry number for 1-Methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 1313760-71-2) is a chemical compound with the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. IUPAC name: 1-methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: YGURGQQXRJHHKZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O4 |
|---|---|
| Molecular weight | 302.14 g/mol |
| IUPAC name | 1-methyl-5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | YGURGQQXRJHHKZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=C(C=C3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)