CAS 131379-16-3 appears in our catalog under these names: 4–(Ethoxycarbonyl)phenylzinc iodide solution 0·5M in THF, 4-Ethoxycarbonylphenylzinc iodide 0.5 M in Tetrahydrofuran. Offered by: GLPBio, Biosynth. Available pack sizes: 50ml, 250ml.
Ethyl benzoate;iodozinc(1+) (CAS 131379-16-3) is a chemical compound with the molecular formula C9H9IO2Zn and a molecular weight of 341.5 g/mol. IUPAC name: ethyl benzoate;iodozinc(1+). InChIKey: DVAYVJGYZRYJEV-UHFFFAOYSA-M.
| Molecular formula | C9H9IO2Zn |
|---|---|
| Molecular weight | 341.5 g/mol |
| IUPAC name | ethyl benzoate;iodozinc(1+) |
| InChIKey | DVAYVJGYZRYJEV-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=[C-]C=C1.[Zn+]I |
Computed by PubChem (NCBI)