CAS 282727-18-8 is the registry number for 3-Ethoxycarbonylphenylzinc iodide 0.5 M in Tetrahydrofuran. Offered by: Biosynth. Available pack sizes: 250ml.
Ethyl benzoate;iodozinc(1+) (CAS 282727-18-8) is a chemical compound with the molecular formula C9H9IO2Zn and a molecular weight of 341.5 g/mol. IUPAC name: ethyl benzoate;iodozinc(1+). InChIKey: KNTSJWIWLNBYJL-UHFFFAOYSA-M.
| Molecular formula | C9H9IO2Zn |
|---|---|
| Molecular weight | 341.5 g/mol |
| IUPAC name | ethyl benzoate;iodozinc(1+) |
| InChIKey | KNTSJWIWLNBYJL-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=C[C-]=C1.[Zn+]I |
Computed by PubChem (NCBI)