CAS 13138-72-2 appears in our catalog under these names: 5–Nitro–1H–pyrrole–2–carboxylic acid, 5-Nitro-1h-pyrrole-2-carboxylic acid, 95%, 5-Nitro-1H-pyrrole-2-carboxylic acid, 97%, 5-Nitro-1H-pyrrole-2-carboxylic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
5-nitro-1H-pyrrole-2-carboxylic acid (CAS 13138-72-2) is a chemical compound with the molecular formula C5H4N2O4 and a molecular weight of 156.10 g/mol. IUPAC name: 5-nitro-1H-pyrrole-2-carboxylic acid. InChIKey: VAOZHQMZMOXIRY-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O4 |
|---|---|
| Molecular weight | 156.10 g/mol |
| IUPAC name | 5-nitro-1H-pyrrole-2-carboxylic acid |
| InChIKey | VAOZHQMZMOXIRY-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)